| SpectraBase Spectrum ID |
JvuODm4vMsT |
| Name |
Orphenadrine |
| CAS Registry Number |
83-98-7 |
| Collision Energy |
10 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
269.177964364 u |
| Formula |
C18H23NO |
| InChI |
InChI=1S/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3 |
| InChIKey |
QVYRGXJJSLMXQH-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
269.388 g/mol |
| Nominal Mass |
269 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
270.185 |
| SMILES |
C(OCCN(C)C)(C=1C(=CC=CC1)C)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
N,N-dimethyl-2-[(2-methylphenyl)-phenylmethoxy]ethanamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_679.1 |