| SpectraBase Spectrum ID |
Jr7mySSyzgF |
| Name |
Methyl 3-(dimethylamino)-6-methoxy-1H-indole-2-carboxylate |
| Appearance |
Yellow solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C13H16N2O3 |
| InChI |
InChI=1S/C13H16N2O3/c1-15(2)12-9-6-5-8(17-3)7-10(9)14-11(12)13(16)18-4/h5-7,14H,1-4H3 |
| InChIKey |
GPLMNTNQQOPOQG-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
248.282 g/mol |
| Reported Formula |
C13H16N2O3 |
| SMILES |
[nH]1c2c(c(c1C(OC)=O)N(C)C)ccc(c2)OC |
| SPLASH |
splash10-01b9-0930000000-ec689429a07540e7c215 |
| Source of Spectrum |
ARK-2014-44-2b |
| Thin-Layer Chromatography |
Rf = 0.8 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843234 |
