| SpectraBase Spectrum ID |
Jbjq1M5uElg |
| Name |
6-Deisopropylatrazine |
| CAS Registry Number |
1007-28-9 |
| Collision Energy |
15 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
173.046822978 u |
| Formula |
C5H8ClN5 |
| InChI |
InChI=1S/C5H8ClN5/c1-2-8-5-10-3(6)9-4(7)11-5/h2H2,1H3,(H3,7,8,9,10,11) |
| InChIKey |
IVENSCMCQBJAKW-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
173.607 g/mol |
| Nominal Mass |
173 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
174.054 |
| SMILES |
N(CC)C=1N=C(N=C(N1)Cl)N |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
6-chloro-2-N-ethyl-1,3,5-triazine-2,4-diamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_74.2 |
