| SpectraBase Spectrum ID |
JInjbSS4zPU |
| Name |
Desoxymethyltestosterone |
| CAS Registry Number |
3275-64-7 |
| Classification |
Pharmaceutical drug, anabolic-androgenic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (22) |
| DEA Controlled Substance Name |
desoxymethyltestosterone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
288.245315649 u |
| Formula |
C20H32O |
| InChI |
InChI=1S/C20H32O/c1-18-11-5-4-6-14(18)7-8-15-16(18)9-12-19(2)17(15)10-13-20(19,3)21/h4-5,14-17,21H,6-13H2,1-3H3/t14-,15-,16+,17+,18+,19+,20+/m1/s1 |
| InChIKey |
FRVHJVATKMIOPQ-PAPWGAKMSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
288.475 g/mol |
| Nominal Mass |
288 u |
| Quality |
981 |
| Retention Index |
2199 |
| SMILES |
O[C@@]1([C@@]2([C@]([C@]3([C@@]([C@@]4([C@@](CC3)(CC=CC4)[H])C)(CC2)[H])[H])(CC1)[H])C)C |
| SPLASH |
splash10-052f-9720000000-eafb21a8f479d9eb41b4 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
17alpha-Methyl-5alpha-androst-2-en-17-beta-ol |
| Technique |
GC/MS |
| Wiley ID |
DD2024_023474 |
