| SpectraBase Spectrum ID |
JGUXN3NYGQq |
| Name |
Pregabaline |
| CAS Registry Number |
148553-50-8 |
| Classification |
Pharmaceutical drug, antiepileptic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.15 (e) (6) |
| DEA Controlled Substance Name |
Pregabalin |
| DEA Controlled Substance Type |
Salts |
| DEA Controlled Substances Code Number |
2782 |
| DEA Schedule |
Schedule V |
| DEA Section |
Depressants. Unless specifically exempted or excluded or unless listed in another schedule, any material, compound, mixture, or preparation which contains any quantity of the following substances having a depressant effect on the central nervous system, including its salts |
| Exact Mass |
159.125928789 u |
| Formula |
C8H17NO2 |
| InChI |
InChI=1S/C8H17NO2/c1-6(2)3-7(5-9)4-8(10)11/h6-7H,3-5,9H2,1-2H3,(H,10,11)/t7-/m0/s1 |
| InChIKey |
AYXYPKUFHZROOJ-ZETCQYMHSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
159.229 g/mol |
| Nominal Mass |
159 u |
| Quality |
823 |
| Retention Index |
1290 |
| SMILES |
OC(C[C@@](CN)(CC(C)C)[H])=O |
| SPLASH |
splash10-0006-9100000000-06bc95124308b41bcf78 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
3-Isobutyl GABA
(3S)-3-(Aminomethyl)-5-methylhexanoic acid |
| Technique |
GC/MS |
| Wiley ID |
DD2024_013647 |
