| SpectraBase Spectrum ID |
JFwugttUJAe |
| Name |
Dehydrochloromethyltestosterone |
| CAS Registry Number |
2446-23-3 |
| Classification |
Pharmaceutical drug, anabolic androgenic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (21) |
| DEA Controlled Substance Name |
dehydrochloromethyltestosterone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
334.169957807 u |
| Formula |
C20H27ClO2 |
| InChI |
InChI=1S/C20H27ClO2/c1-18-9-8-16(22)17(21)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,3)23/h8-9,12-14,23H,4-7,10-11H2,1-3H3/t12-,13+,14+,18-,19+,20+/m1/s1 |
| InChIKey |
AGUNEISBPXQOPA-XMUHMHRVSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
334.887 g/mol |
| Nominal Mass |
334 u |
| Quality |
971 |
| Retention Index |
2932 |
| SMILES |
O[C@@]1([C@@]2([C@]([C@]3([C@@]([C@@]4(C(=C(C(C=C4)=O)Cl)CC3)C)(CC2)[H])[H])(CC1)[H])C)C |
| SPLASH |
splash10-07bf-2940000000-8e35ed4c867d27109a7d |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
CDMT
4-Chloro-methandienone
Oral Turinabol
(1S,3aS,3bR,9aR,9bS,11aS)-6-chloro-1-hydroxy-1,9a,11a-trimethyl-1,2,3,3a,3b,4,5,9a,9b,10,11,\r11a-dodecahydro-7H-cyclopenta[a]phenanthren-7-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014946 |
