| SpectraBase Spectrum ID |
JFAVxmseHM8 |
| Name |
Chloromethyltestosterone |
| CAS Registry Number |
5785-58-0 |
| Classification |
Pharmaceutical drug, anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (18) |
| DEA Controlled Substance Name |
4-chloro-17α-methyl-17β-hydroxy-androst-4-en-3-one |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
336.185607872 u |
| Formula |
C20H29ClO2 |
| InChI |
InChI=1S/C20H29ClO2/c1-18-9-8-16(22)17(21)15(18)5-4-12-13(18)6-10-19(2)14(12)7-11-20(19,3)23/h12-14,23H,4-11H2,1-3H3/t12-,13+,14+,18-,19+,20+/m1/s1 |
| InChIKey |
SOMOGWLYTLQJGT-XMUHMHRVSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
336.903 g/mol |
| Nominal Mass |
336 u |
| Quality |
983 |
| Retention Index |
2601 |
| SMILES |
O[C@@]1([C@@]2([C@]([C@]3([C@@]([C@@]4(C(=C(C(CC4)=O)Cl)CC3)C)(CC2)[H])[H])(CC1)[H])C)C |
| SPLASH |
splash10-08fu-2961000000-e2c7824477e31024532a |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(17beta)-4-Chloro-17-hydroxy-17(alpha)-methylandrost-4-en-3-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014947 |
