| SpectraBase Spectrum ID |
J3wBaLNf3pI |
| Name |
N-{[(9H-fluoren-9-yl)methoxy]carbonyl}amino-L-glutamic acid 5-tert-butyl ester |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
H59169 |
| Lot Number |
M05D020 |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270633 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-11153 |
| Backward Peak Location |
14450 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
71989-18-9 |
| Color Properties |
White |
| Container ID |
C-008943 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C24H27NO6 |
| Frequency of First Point |
3999.54 cm⁻¹ |
| Frequency of Last Point |
339.945 cm⁻¹ |
| High Folding Limit |
15800.5 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C24H27NO6/c1-24(2,3)31-21(26)13-12-20(22(27)28)25-23(29)30-14-19-17-10-6-4-8-15(17)16-9-5-7-11-18(16)19/h4-11,19-20H,12-14H2,1-3H3,(H,25,29)(H,27,28)/t20-/m0/s1 |
| InChIKey |
OTKXCALUHMPIGM-FQEVSTJZSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Non Linearity Correction |
0 |
| Number of Points |
15180 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-11254 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14506 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Physical State |
Solid |
| Preamplifier Gain Background |
0 |
| Purity |
98% |
| Relative Humidity Interferometer |
10 % |
| Resolution |
2 |
| SKU |
H59169-5G |
| SMILES |
OC([C@](CCC(OC(C)(C)C)=O)(NC(=O)OCC1c2ccccc2-c2ccccc12)[H])=O |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.036 s |
| Scanner Temperature |
30.9 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
Fmoc-L-glutamic acid 5-tert-butyl ester |
| Technique |
KBr0 |
| Zero Filling Factor |
8 |
![N-{[(9H-fluoren-9-yl)methoxy]carbonyl}amino-L-glutamic acid 5-tert-butyl ester](/api/spectrum/J3wBaLNf3pI/structure.png?h=300&w=458 "N-{[(9H-fluoren-9-yl)methoxy]carbonyl}amino-L-glutamic acid 5-tert-butyl ester")
