| SpectraBase Spectrum ID |
IfCfknbXybp |
| Name |
(2S,5R/S)-5-Vinylpyrrolidine-2-carboxylic acid ethyl ester |
| Appearance |
Yellowish oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C9H15NO2 |
| InChI |
InChI=1S/C9H15NO2/c1-3-7-5-6-8(10-7)9(11)12-4-2/h3,7-8,10H,1,4-6H2,2H3/t7?,8-/m0/s1 |
| InChIKey |
ZAOGTANDWGQXED-MQWKRIRWSA-N |
| Instrument Name |
Finnigan MAT Incos 50 Galaxy |
| Ionization Type |
EI |
| Molecular Weight |
169.224 g/mol |
| Optical Rotation |
[a]D20 = -39.8 (c = 1.065, CHCl3) |
| Reported Formula |
C9H15NO2 |
| SMILES |
N1C(CC[C@]1(C(=O)OCC)[H])C=C |
| SPLASH |
splash10-0002-9000000000-6680330909dcafaf58ac |
| Sample Comments |
mixture of diastereomers, cis/trans (4:1), cis/trans (4:1) |
| Source of Spectrum |
US20110034438A1 |
| Thin-Layer Chromatography |
Rf = 0.19(SiO2, CH2Cl3/MeOH, 25:1) |
| Wiley ID |
1861636 |
