| SpectraBase Spectrum ID |
If03EnPEGVF |
| Name |
Phenylenediamine |
| CAS Registry Number |
25265-76-3 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
108.068748266 u |
| Formula |
C6H8N2 |
| InChI |
InChI=1S/C6H8N2/c7-5-1-2-6(8)4-3-5/h1-4H,7-8H2 |
| InChIKey |
CBCKQZAAMUWICA-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
108.144 g/mol |
| Nominal Mass |
108 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
109.076 |
| SMILES |
NC1=CC=C(N)C=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
benzene-1,4-diamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_741.8 |