| SpectraBase Spectrum ID |
IHZXgpLh73G |
| Name |
Chlorpropham |
| CAS Registry Number |
101-21-3 |
| Collision Energy |
25 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
213.055656328 u |
| Formula |
C10H12ClNO2 |
| InChI |
InChI=1S/C10H12ClNO2/c1-7(2)14-10(13)12-9-5-3-4-8(11)6-9/h3-7H,1-2H3,(H,12,13) |
| InChIKey |
CWJSHJJYOPWUGX-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
213.664 g/mol |
| Nominal Mass |
213 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
214.063 |
| SMILES |
N(C1=CC(Cl)=CC=C1)C(OC(C)C)=O |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
propan-2-yl N-(3-chlorophenyl)carbamate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_203.14 |