| SpectraBase Spectrum ID |
I1Tuv1uC7x9 |
| Name |
3,4,5-trimethyl-2-thiophenecarboxylic acid |
| Appearance |
Colorless needles |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C8H10O2S |
| InChI |
InChI=1S/C8H10O2S/c1-4-5(2)7(8(9)10)11-6(4)3/h1-3H3,(H,9,10) |
| InChIKey |
ZHSGKMPXEWBKBM-UHFFFAOYSA-N |
| Instrument Name |
JEOL DX-303 and SX-102A |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1021/np010541h |
| Molecular Weight |
170.226 g/mol |
| Reported Formula |
C8H10O2S |
| SMILES |
OC(c1c(c(c(s1)C)C)C)=O |
| SPLASH |
splash10-05fr-9800000000-eac337334c5fd6934f89 |
| Source of Spectrum |
G4-65-1669-5 |
| Synonyms |
Foetithiophene A |
| Wiley ID |
1880995 |
