| SpectraBase Spectrum ID |
I0aFE4vMJiq |
| Name |
Lamotrigine |
| CAS Registry Number |
84057-84-1 |
| Collision Energy |
10 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
255.007850645 u |
| Formula |
C9H7Cl2N5 |
| InChI |
InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16) |
| InChIKey |
PYZRQGJRPPTADH-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
256.096 g/mol |
| Nominal Mass |
255 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
256.015 |
| SMILES |
NC=1N=C(N=NC1C1=C(Cl)C(Cl)=CC=C1)N |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
6-(2,3-dichlorophenyl)-1,2,4-triazine-3,5-diamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_468.1 |