| SpectraBase Spectrum ID |
Htw0yZmmzyK |
| Name |
5,6,7,8-Tetrahydro-1-naphthol |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
T2816 |
| Lot Number |
SMJ8E-NF |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
4 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270583 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
32 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-6478 |
| Backward Peak Location |
14480 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
529-35-1 |
| Container ID |
C-010364 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C10H12O |
| Frequency of First Point |
3999.76 cm⁻¹ |
| Frequency of Last Point |
339.943 cm⁻¹ |
| High Folding Limit |
15800.4 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 |
| InChIKey |
SCWNNOCLLOHZIG-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.4 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Molecular Weight |
148.205 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
15181 |
| Number of Sample Scans |
32 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-6363 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14476 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Physical State |
Solid |
| Preamplifier Gain Background |
0 |
| Purity |
>98.0% |
| Relative Humidity Interferometer |
0 % |
| Resolution |
2 |
| SKU |
T2816-5G |
| SMILES |
Oc1cccc2CCCCc12 |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
50.05 s |
| Scanner Temperature |
29.9 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Solvent |
Dichloromethane |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Technique |
Film |
| Window |
KBr Window |
| Zero Filling Factor |
8 |
