| SpectraBase Spectrum ID |
HPuRsjvWcU5 |
| Name |
Dimethisoquin |
| CAS Registry Number |
86-80-6 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
272.188863400 u |
| Formula |
C17H24N2O |
| InChI |
InChI=1S/C17H24N2O/c1-4-5-9-15-13-14-8-6-7-10-16(14)17(18-15)20-12-11-19(2)3/h6-8,10,13H,4-5,9,11-12H2,1-3H3 |
| InChIKey |
XNMYNYSCEJBRPZ-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
272.392 g/mol |
| Nominal Mass |
272 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
273.196 |
| SMILES |
C1(OCCN(C)C)=NC(CCCC)=CC=2C1=CC=CC2 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(3-butylisoquinolin-1-yl)oxy-N,N-dimethylethanamine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_295.5 |
