| SpectraBase Spectrum ID |
HLE48ljfxfB |
| Name |
Prenylamine |
| CAS Registry Number |
390-64-7 |
| Collision Energy |
20 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
329.214349873 u |
| Formula |
C24H27N |
| InChI |
InChI=1S/C24H27N/c1-20(19-21-11-5-2-6-12-21)25-18-17-24(22-13-7-3-8-14-22)23-15-9-4-10-16-23/h2-16,20,24-25H,17-19H2,1H3 |
| InChIKey |
IFFPICMESYHZPQ-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
329.487 g/mol |
| Nominal Mass |
329 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
330.222 |
| SMILES |
N(CCC(C1=CC=CC=C1)C1=CC=CC=C1)C(CC1=CC=CC=C1)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3,3-diphenyl-N-(1-phenylpropan-2-yl)propan-1-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_865.3 |
