| SpectraBase Spectrum ID |
Gy1wDqrKpLi |
| Name |
2-[(3,5-Dimethoxyphenyl)amino]-1-phenylethanone |
| Appearance |
Yellow solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H17NO3 |
| InChI |
InChI=1S/C16H17NO3/c1-19-14-8-13(9-15(10-14)20-2)17-11-16(18)12-6-4-3-5-7-12/h3-10,17H,11H2,1-2H3 |
| InChIKey |
FPOCOJDQIJAJNP-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
271.316 g/mol |
| Reported Formula |
C16H17NO3 |
| SMILES |
N(c1cc(cc(OC)c1)OC)CC(=O)c1ccccc1 |
| SPLASH |
splash10-01b9-0920000000-0c7d45776a26f1769b85 |
| Source of Spectrum |
ARK-2014-34-4o |
| Thin-Layer Chromatography |
Rf = 0.56 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843275 |
![2-[(3,5-Dimethoxyphenyl)amino]-1-phenylethanone](/api/spectrum/Gy1wDqrKpLi/structure.png?h=300&w=458 "2-[(3,5-Dimethoxyphenyl)amino]-1-phenylethanone")
