| SpectraBase Spectrum ID |
GbqeI3D2sxk |
| Name |
Caramiphen |
| CAS Registry Number |
77-22-5 |
| Collision Energy |
10 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
289.204179111 u |
| Formula |
C18H27NO2 |
| InChI |
InChI=1S/C18H27NO2/c1-3-19(4-2)14-15-21-17(20)18(12-8-9-13-18)16-10-6-5-7-11-16/h5-7,10-11H,3-4,8-9,12-15H2,1-2H3 |
| InChIKey |
OFAIGZWCDGNZGT-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
289.419 g/mol |
| Nominal Mass |
289 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
290.212 |
| SMILES |
C(OCCN(CC)CC)(=O)C1(CCCC1)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-(diethylamino)ethyl 1-phenylcyclopentane-1-carboxylate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_160.1 |
