| SpectraBase Spectrum ID |
GWovgETSMAC |
| Name |
Metenolone acetate |
| CAS Registry Number |
434-05-9 |
| Classification |
Pharmaceutical drug, anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (49) |
| DEA Controlled Substance Name |
methenolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
344.235144887 u |
| Formula |
C22H32O3 |
| InChI |
InChI=1S/C22H32O3/c1-13-11-16(24)12-15-5-6-17-18-7-8-20(25-14(2)23)21(18,3)10-9-19(17)22(13,15)4/h11,15,17-20H,5-10,12H2,1-4H3/t15-,17-,18?,19-,20-,21-,22-/m0/s1 |
| InChIKey |
PGAUJQOPTMSERF-IGVCSHKNSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
344.495 g/mol |
| Nominal Mass |
344 u |
| Quality |
981 |
| Retention Index |
2707 |
| SMILES |
[C@@]12([C@@]3([C@@](CC[C@]2(C2[C@@]([C@](CC2)(OC(=O)C)[H])(CC1)C)[H])(CC(C=C3C)=O)[H])C)[H] |
| SPLASH |
splash10-007c-5900000000-7cde9ab7b4c2f1f2b58a |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3bR,5aS,9aS,9bS,11aS)-9,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,6,7,9a,9b,10,11,11a-\rtetradecahydro-1H-cyclopenta[a]phenanthren-1-yl acetate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_001943 |
