| SpectraBase Spectrum ID |
GU452Hzj6gw |
| Name |
2-Amino-3-cyano-4-(benzo[d][1,3]dioxol-6-yl)-6-(10,10a-dihydro-4aH-phenothiazin-2-yl)pyridine |
| Appearance |
Dark orange crystals |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C25H18N4O2S |
| InChI |
InChI=1S/C25H18N4O2S/c26-12-17-16(14-5-7-21-22(10-14)31-13-30-21)11-19(29-25(17)27)15-6-8-24-20(9-15)28-18-3-1-2-4-23(18)32-24/h1-11,20,24,28H,13H2,(H2,27,29) |
| InChIKey |
LLGSHABKQWUNOW-UHFFFAOYSA-N |
| Instrument Name |
Kratos and Varian MAT 311A |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1002/jhet.3771 |
| Molecular Weight |
438.505 g/mol |
| SMILES |
Nc1nc(C2=CC3C(Sc4c(cccc4)N3)C=C2)cc(c1C#N)-c1cc2c(OCO2)cc1 |
| SPLASH |
splash10-000i-0010900000-3710cf0e24434009d6b9 |
| Source of Spectrum |
Y-57-264-11a |
| Thin-Layer Chromatography |
Rf = 0.68, (PE (40-60): EtOAc, 4:1) |
| Wiley ID |
1859765 |
![2-Amino-3-cyano-4-(benzo[d][1,3]dioxol-6-yl)-6-(10,10a-dihydro-4aH-phenothiazin-2-yl)pyridine](/api/spectrum/GU452Hzj6gw/structure.png?h=300&w=458 "2-Amino-3-cyano-4-(benzo[d][1,3]dioxol-6-yl)-6-(10,10a-dihydro-4aH-phenothiazin-2-yl)pyridine")
