| SpectraBase Spectrum ID |
GGXQCqu7a7V |
| Name |
3-Cyano-4-(benzo[d][1,3]dioxol-5-yl)-2-morpholino-6-(10H-phenothiazin-8-yl)pyridine |
| Appearance |
Dark orange crystals |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C29H22N4O3S |
| InChI |
InChI=1S/C29H22N4O3S/c30-16-21-20(18-5-7-25-26(14-18)36-17-35-25)15-23(32-29(21)33-9-11-34-12-10-33)19-6-8-28-24(13-19)31-22-3-1-2-4-27(22)37-28/h1-8,13-15,31H,9-12,17H2 |
| InChIKey |
OUXMCBFJYPNYSW-UHFFFAOYSA-N |
| Instrument Name |
Kratos and Varian MAT 311A |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1002/jhet.3771 |
| Molecular Weight |
506.580 g/mol |
| SMILES |
N1c2c(Sc3c1cc(cc3)-c1nc(c(C#N)c(c1)-c1ccc3c(OCO3)c1)N1CCOCC1)cccc2 |
| SPLASH |
splash10-0006-0090000000-9f041c68da718e1d03e0 |
| Source of Spectrum |
Y-57-264-9b |
| Thin-Layer Chromatography |
Rf = 0.37 (PE (40-60): EtOAc, 4:1) |
| Wiley ID |
1859783 |
![3-Cyano-4-(benzo[d][1,3]dioxol-5-yl)-2-morpholino-6-(10H-phenothiazin-8-yl)pyridine](/api/spectrum/GGXQCqu7a7V/structure.png?h=300&w=458 "3-Cyano-4-(benzo[d][1,3]dioxol-5-yl)-2-morpholino-6-(10H-phenothiazin-8-yl)pyridine")
