| SpectraBase Spectrum ID |
G3w3MrWgmjU |
| Name |
acetic acid [(1S,3E)-1-[(E)-1-(acetoxymethyl)-3-keto-prop-1-enyl]-4,8-dimethyl-nona-3,7-dien-5-ynyl] ester |
| Compound Number |
20 |
| Copyright |
Copyright © 2016-2024 W. Robien, Inst. of Org. Chem., Univ. of Vienna. All Rights Reserved. |
| Formula |
C19H24O5 |
| InChI |
InChI=1S/C19H24O5/c1-14(2)7-6-8-15(3)9-10-19(24-17(5)22)18(11-12-20)13-23-16(4)21/h7,9,11-12,19H,10,13H2,1-5H3/b15-9+,18-11+/t19-/m0/s1 |
| InChIKey |
ZNJRJRLDPRAASN-FXLUSVPFSA-N |
| Literature Reference Author |
J.T.HANDLEY,A.J.BLACKMAN |
| Literature Reference Citation |
AUSTR.J.CHEM.,58,39(2005) |
| Literature Reference DOI |
10.1071/CH04174 |
| Molecular Weight |
332.397 g/mol |
| Sample ID |
28904 |
| Solvent |
C6D6 |
![acetic acid [(1S,3E)-1-[(E)-1-(acetoxymethyl)-3-keto-prop-1-enyl]-4,8-dimethyl-nona-3,7-dien-5-ynyl] ester](/api/spectrum/G3w3MrWgmjU/structure.png?h=300&w=458 "acetic acid [(1S,3E)-1-[(E)-1-(acetoxymethyl)-3-keto-prop-1-enyl]-4,8-dimethyl-nona-3,7-dien-5-ynyl] ester")
