| SpectraBase Spectrum ID |
FyD5kB3kzci |
| Name |
1-Hydroxy-ethyl phenylphosphinous acid-borane ethyl ester |
| Appearance |
Volatile oil |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H18BO2P |
| InChI |
InChI=1S/C10H15O2P.BH3/c1-3-12-13(9(2)11)10-7-5-4-6-8-10;/h4-9,11H,3H2,1-2H3;1H3 |
| InChIKey |
QNJUEIDXRUWTJM-UHFFFAOYSA-N |
| Instrument Name |
Shimadzu GC??MS QP2010S |
| Ionization Type |
EI |
| Literature Reference DOI |
10.1002/ejoc.201801518 |
| Molecular Weight |
212.036 g/mol |
| SMILES |
OC(P(c1ccccc1)OCC)C.B |
| SPLASH |
splash10-004i-9400000000-9683ada327bd362dfe7c |
| Source of Spectrum |
U1-2019-932-7a |
| Thin-Layer Chromatography |
Rf = 0.34 and 0.29 (hexane/ AcOEt, 4:1) |
| Wiley ID |
1843711 |
