| SpectraBase Spectrum ID |
FornecR8R5 |
| Name |
1-(4,6-Dimethoxy-1H-indol-2-yl)ethanone |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C12H13NO3 |
| InChI |
InChI=1S/C12H13NO3/c1-7(14)10-6-9-11(13-10)4-8(15-2)5-12(9)16-3/h4-6,13H,1-3H3 |
| InChIKey |
SSRMGVHEQKCUEC-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
219.240 g/mol |
| Reported Formula |
C12H13NO3 |
| SMILES |
[nH]1c(cc2c1cc(cc2OC)OC)C(C)=O |
| SPLASH |
splash10-0gb9-1890000000-1479e3c385558def5233 |
| Source of Spectrum |
ARK-2014-42-1j |
| Thin-Layer Chromatography |
Rf = 0.42 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843228 |
