| SpectraBase Spectrum ID |
FSqkZkR2OlE |
| Name |
(Z)-4-(Dimethylamino)-3-[(3-methoxyphenyl)amino]but-3-en-2-one |
| Appearance |
Greenish-brown gum |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C13H18N2O2 |
| InChI |
InChI=1S/C13H18N2O2/c1-10(16)13(9-15(2)3)14-11-6-5-7-12(8-11)17-4/h5-9,14H,1-4H3/b13-9- |
| InChIKey |
CZYJKDVLCBEOBE-LCYFTJDESA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
234.299 g/mol |
| Reported Formula |
C13H18N2O2 |
| SMILES |
N(\C(=C/N(C)C)C(C)=O)c1cc(ccc1)OC |
| SPLASH |
splash10-001i-0890000000-3331f2967830a12db6bd |
| Source of Spectrum |
ARK-2014-37-3i |
| Thin-Layer Chromatography |
Rf = 0.23 (EtOAc) |
| Wiley ID |
1843255 |
![(Z)-4-(Dimethylamino)-3-[(3-methoxyphenyl)amino]but-3-en-2-one](/api/spectrum/FSqkZkR2OlE/structure.png?h=300&w=458 "(Z)-4-(Dimethylamino)-3-[(3-methoxyphenyl)amino]but-3-en-2-one")
