| SpectraBase Spectrum ID |
FBrKZuG71KD |
| Name |
Tetrazepam |
| CAS Registry Number |
10379-14-3 |
| Collision Energy |
35 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
288.102940874 u |
| Formula |
C16H17ClN2O |
| InChI |
InChI=1S/C16H17ClN2O/c1-19-14-8-7-12(17)9-13(14)16(18-10-15(19)20)11-5-3-2-4-6-11/h5,7-9H,2-4,6,10H2,1H3 |
| InChIKey |
IQWYAQCHYZHJOS-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
288.778 g/mol |
| Nominal Mass |
288 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
289.11 |
| SMILES |
C1(Cl)=CC=2C(=NCC(=O)N(C2C=C1)C)C=1CCCCC1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
7-chloro-5-(cyclohexen-1-yl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_928.6 |
