| SpectraBase Spectrum ID |
FA9QY7Peyfv |
| Name |
1-[1-(Dimethylamino)-3H-benz[e]indol-2-yl]ethanone |
| Appearance |
Red crystals |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C16H16N2O |
| InChI |
InChI=1S/C16H16N2O/c1-10(19)15-16(18(2)3)14-12-7-5-4-6-11(12)8-9-13(14)17-15/h4-9,17H,1-3H3 |
| InChIKey |
BROSXLPQBZIZAO-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
252.317 g/mol |
| Reported Formula |
C16H16N2O |
| SMILES |
[nH]1c2c(c(c1C(C)=O)N(C)C)c1c(cc2)cccc1 |
| SPLASH |
splash10-0f79-0970000000-be70af0f21ec1f07b9af |
| Source of Spectrum |
ARK-2014-47-2m |
| Thin-Layer Chromatography |
Rf = 0.42 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843245 |
![1-[1-(Dimethylamino)-3H-benz[e]indol-2-yl]ethanone](/api/spectrum/FA9QY7Peyfv/structure.png?h=300&w=458 "1-[1-(Dimethylamino)-3H-benz[e]indol-2-yl]ethanone")
