| SpectraBase Spectrum ID |
F8OJ2kY5RsZ |
| Name |
Methyl 2-(phenylamino)acetate |
| Appearance |
Brown solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C9H11NO2 |
| InChI |
InChI=1S/C9H11NO2/c1-12-9(11)7-10-8-5-3-2-4-6-8/h2-6,10H,7H2,1H3 |
| InChIKey |
SZJUWKPNWWCOPG-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
165.192 g/mol |
| Reported Formula |
C9H11NO2 |
| SMILES |
N(CC(OC)=O)c1ccccc1 |
| SPLASH |
splash10-000i-9300000000-d0f49c51373c84e44f8a |
| Source of Spectrum |
ARK-2014-30-4a |
| Thin-Layer Chromatography |
Rf = 0.60 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843262 |
