| SpectraBase Spectrum ID |
EvmyMdEZZgJ |
| Name |
Ethaverine |
| CAS Registry Number |
486-47-5 |
| Collision Energy |
25 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
395.209658414 u |
| Formula |
C24H29NO4 |
| InChI |
InChI=1S/C24H29NO4/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20/h9-12,14-16H,5-8,13H2,1-4H3 |
| InChIKey |
ZOWYFYXTIWQBEP-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
395.499 g/mol |
| Nominal Mass |
395 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
396.217 |
| SMILES |
C=1(OCC)C=C2C(=NC=CC2=CC1OCC)CC1=CC(OCC)=C(OCC)C=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxyisoquinoline |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_340.4 |
