| SpectraBase Spectrum ID |
EuhrnG70WdA |
| Name |
(S)-atrochrysone |
| Appearance |
Green-yellow needles |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Exact Mass |
274.084123546 u |
| Formula |
C15H14O5 |
| InChI |
InChI=1S/C15H14O5/c1-15(20)5-8-2-7-3-9(16)4-10(17)12(7)14(19)13(8)11(18)6-15/h2-4,16-17,19-20H,5-6H2,1H3/t15-/m0/s1 |
| InChIKey |
FELQSDLZFDTZJN-HNNXBMFYSA-N |
| Instrument Name |
VG Micromass 7070F and JEOL JMS-AX505HF |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0002.712 |
| Optical Rotation |
[a]30.5 = +6.5 (c = 0.8, MeOH) |
| Quality |
258 |
| SMILES |
OC1=CC2=C(C(=C1)O)C(=C1C(C[C@@](CC1=C2)(C)O)=O)O |
| SPLASH |
splash10-05fr-0090000000-1641a65a62eac1e99031 |
| Source of Spectrum |
ARK-2001-154-8 (DOI: 10.3998/ark.5550190.0002.712) |
| Thin-Layer Chromatography |
0.24 |
| Wiley ID |
1908848 |
