| SpectraBase Spectrum ID |
EB7y5AhZgCC |
| Name |
1-(Naphthalen-2-ylamino)propan-2-one |
| Appearance |
Red solid |
| Copyright |
Copyright © 2020-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C13H13NO |
| InChI |
InChI=1S/C13H13NO/c1-10(15)9-14-13-7-6-11-4-2-3-5-12(11)8-13/h2-8,14H,9H2,1H3 |
| InChIKey |
YNKYRFCUEHRXDS-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
199.253 g/mol |
| Reported Formula |
C13H13NO |
| SMILES |
N(c1cc2c(cccc2)cc1)CC(C)=O |
| SPLASH |
splash10-0a6r-0900000000-9c896551f439b6fdb335 |
| Source of Spectrum |
ARK-2014-34-4n |
| Thin-Layer Chromatography |
Rf = 0.43 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843274 |
