| SpectraBase Spectrum ID |
DxVIxGg9Usz |
| Name |
Oxandrolon TMS |
| Classification |
Pharmaceutical drug artifact |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (76) |
| DEA Controlled Substance Name |
oxandrolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
378.259021616 u |
| Formula |
C22H38O3Si |
| InChI |
InChI=1S/C22H38O3Si/c1-20-14-24-19(23)13-15(20)7-8-16-17(20)9-11-21(2)18(16)10-12-22(21,3)25-26(4,5)6/h15-18H,7-14H2,1-6H3/t15-,16+,17-,18-,20-,21-,22-/m0/s1 |
| InChIKey |
CKIOLCLYRVAWDL-BSMDRJKDSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
378.628 g/mol |
| Nominal Mass |
378 u |
| Quality |
999 |
| Retention Index |
2940 |
| SMILES |
[C@@]12([C@]3([C@@]([C@](CC3)(O[Si](C)(C)C)C)(CC[C@@]1([C@@]1([C@@](CC2)(CC(OC1)=O)[H])C)[H])C)[H])[H] |
| SPLASH |
splash10-06r6-1719000000-a4862633f0d1fe2fde29 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(4aS,4bS,6aS,7S,9aS,9bR,11aS)-4a,6a,7-trimethyl-7-((trimethylsilyl)oxy)tetradecahydroindeno\r[4,5-h]isochromen-2(1H)-one |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014459 |
