| SpectraBase Spectrum ID |
DsnfB58ATpz |
| Name |
Dehydrochloromethyltestosterone AC |
| Classification |
Pharmaceutical drug, anabolic androgenic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (21) |
| DEA Controlled Substance Name |
dehydrochloromethyltestosterone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
376.180522491 u |
| Formula |
C22H29ClO3 |
| InChI |
InChI=1S/C22H29ClO3/c1-13(24)26-22(4)12-8-16-14-5-6-17-19(23)18(25)9-10-20(17,2)15(14)7-11-21(16,22)3/h9-10,14-16H,5-8,11-12H2,1-4H3/t14-,15+,16+,20-,21+,22+/m1/s1 |
| InChIKey |
OCRNZVQEFZEIJU-OFUYBIASSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
376.924 g/mol |
| Nominal Mass |
376 u |
| Quality |
915 |
| Retention Index |
3065 |
| SMILES |
[C@]12([C@]([C@]3([C@@]([C@](CC3)(OC(=O)C)C)(CC1)C)[H])(CCC=1[C@@]2(C=CC(C1Cl)=O)C)[H])[H] |
| SPLASH |
splash10-0006-5920000000-8262dbd07543a8953888 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bR,9aR,9bS,11aS)-6-chloro-1,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,7,9a,9b,10,\r11,11a-dodecahydro-1H-cyclopenta[a]phenanthren-1-yl acetate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_004388 |
