| SpectraBase Spectrum ID |
DsBSY4klXki |
| Name |
Methyl-phenyl-phenylsulfanylmethyl-amine |
| Appearance |
Colorless oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H15NS |
| InChI |
InChI=1S/C14H15NS/c1-15(13-8-4-2-5-9-13)12-16-14-10-6-3-7-11-14/h2-11H,12H2,1H3 |
| InChIKey |
RIMRQKZSKAZYLC-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
229.341 g/mol |
| SMILES |
CN(CSc1ccccc1)c1ccccc1 |
| SPLASH |
splash10-00di-2900000000-9e4702cbfab490130a42 |
| Source of Spectrum |
ARK-2005-163-35a |
| Thin-Layer Chromatography |
Rf = 0.47 (diethyl ether/petroleum ether, 1:6) |
| Wiley ID |
1871028 |
