| SpectraBase Spectrum ID |
DoitWhBaJ04 |
| Name |
1-Androstendione |
| CAS Registry Number |
571-40-4 |
| Classification |
Pharmaceutical drug, anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (7) |
| DEA Controlled Substance Name |
1-androstenedione |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
286.193280075 u |
| Formula |
C19H26O2 |
| InChI |
InChI=1S/C19H26O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h7,9,12,14-16H,3-6,8,10-11H2,1-2H3/t12-,14-,15-,16-,18-,19-/m0/s1 |
| InChIKey |
WJIQCDPCDVWDDE-WZNAKSSCSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
286.415 g/mol |
| Nominal Mass |
286 u |
| Quality |
995 |
| Retention Index |
2336 |
| SMILES |
[C@]12([C@@]([C@@]3([C@@](CC2)(CC(C=C3)=O)[H])C)(CC[C@]2([C@]1(CCC2=O)[H])C)[H])[H] |
| SPLASH |
splash10-006x-6940000000-0129df441102bf75bd59 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
5alpha-androst-1-en-3,17-dione |
| Technique |
GC/MS |
| Wiley ID |
DD2024_011561 |
