| SpectraBase Spectrum ID |
Do37kqCPAgq |
| Name |
Methandrostenolone AC |
| Classification |
Pharmaceutical drug artifact |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (46) |
| DEA Controlled Substance Name |
methandienone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
342.219494823 u |
| Formula |
C22H30O3 |
| InChI |
InChI=1S/C22H30O3/c1-14(23)25-22(4)12-9-19-17-6-5-15-13-16(24)7-10-20(15,2)18(17)8-11-21(19,22)3/h7,10,13,17-19H,5-6,8-9,11-12H2,1-4H3/t17-,18+,19+,20+,21+,22+/m1/s1 |
| InChIKey |
CZTYKJRMICUZNI-GUCLMQHLSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
342.479 g/mol |
| Nominal Mass |
342 u |
| Quality |
974 |
| Retention Index |
2844 |
| SMILES |
[C@@]12([C@]3([C@@]([C@](CC3)(OC(=O)C)C)(CC[C@@]1([C@@]1(C(CC2)=CC(C=C1)=O)C)[H])C)[H])[H] |
| SPLASH |
splash10-00di-2910000000-703bdb2d54bcb61774be |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bR,9aR,9bS,11aS)-1,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,7,9a,9b,10,11,11a-\rdodecahydro-1H-cyclopenta[a]phenanthren-1-yl acetate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_011551 |
