| SpectraBase Spectrum ID |
DnQA2xE3UVU |
| Name |
5-Androstenediol-3-acetate TMS |
| Classification |
Pharmaceutical drug, androgen anabolic |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (6) |
| DEA Controlled Substance Name |
5-androstenediol |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
404.274671680 u |
| Formula |
C24H40O3Si |
| InChI |
InChI=1S/C24H40O3Si/c1-16(25)26-18-11-13-23(2)17(15-18)7-8-19-20-9-10-22(27-28(4,5)6)24(20,3)14-12-21(19)23/h7,18-22H,8-15H2,1-6H3/t18-,19-,20-,21-,22-,23-,24-/m0/s1 |
| InChIKey |
GZPMQCTWFVYDGP-LQDRYOBXSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
404.666 g/mol |
| Nominal Mass |
404 u |
| Quality |
962 |
| Retention Index |
3091 |
| SMILES |
[C@@]12([C@]3([C@@]([C@](CC3)(O[Si](C)(C)C)[H])(CC[C@@]1([C@@]1(C(=CC2)C[C@](CC1)(OC(=O)C)[H])C)[H])C)[H])[H] |
| SPLASH |
splash10-0f76-3971000000-c0a287bcb30051bb9d25 |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
5-Androsten-3beta,17beta-diol-3-acetate-17-trimethylsilyl ether |
| Technique |
GC/MS |
| Wiley ID |
DD2024_014529 |
