| SpectraBase Spectrum ID |
DjvHRKp8Tiq |
| Name |
Nandrolone PROP |
| Classification |
Pharmaceutical drug derivative |
| Copyright |
Copyright © 2024 DigiLab GmbH and Wiley-VCH GmbH. All Rights Reserved. |
| DEA Citation |
21 CFR §1308.13 (f) (64) |
| DEA Controlled Substance Name |
nandrolone |
| DEA Controlled Substance Type |
Salts, esters and ethers |
| DEA Controlled Substances Code Number |
4000 |
| DEA Schedule |
Schedule III |
| DEA Section |
Anabolic Steroids. Unless specifically excepted or unless listed in another schedule, any material, compound, mixture or preparation containing any quantity of the following substances, including its salts, esters and ethers. |
| Exact Mass |
330.219494823 u |
| Formula |
C21H30O3 |
| InChI |
InChI=1S/C21H30O3/c1-3-20(23)24-19-9-8-18-17-6-4-13-12-14(22)5-7-15(13)16(17)10-11-21(18,19)2/h12,15-19H,3-11H2,1-2H3/t15-,16+,17+,18-,19-,21-/m0/s1 |
| InChIKey |
LGRKCTFWUWAKON-RRFJAZBJSA-N |
| Ionization Type |
Electron Ionization (EI) |
| Molecular Weight |
330.468 g/mol |
| Nominal Mass |
330 u |
| Quality |
962 |
| Retention Index |
2645 |
| SMILES |
[C@]12([C@@]([C@@]3(C(CC2)=CC(CC3)=O)[H])(CC[C@]2([C@]1(CC[C@@]2(OC(CC)=O)[H])[H])C)[H])[H] |
| SPLASH |
splash10-0a4i-4950000000-5925bd1fddef93eab33f |
| Source of Spectrum |
DigiLab GmbH (C) 2024 |
| Synonyms |
(1S,3aS,3bR,9aR,9bS,11aS)-11a-methyl-7-oxo-2,3,3a,3b,4,5,7,8,9,9a,9b,10,11,11a-\rtetradecahydro-1H-cyclopenta[a]phenanthren-1-yl propanoate |
| Technique |
GC/MS |
| Wiley ID |
DD2024_011799 |
