| SpectraBase Spectrum ID |
DV3XM4fovcR |
| Name |
(Z)-Methyl 2-[(3,5-dimethoxyphenyl)amino]-3-(dimethylamino)acrylate |
| Appearance |
Dark-red oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C14H20N2O4 |
| InChI |
InChI=1S/C14H20N2O4/c1-16(2)9-13(14(17)20-5)15-10-6-11(18-3)8-12(7-10)19-4/h6-9,15H,1-5H3/b13-9- |
| InChIKey |
FFCPDKFNDIYVGS-LCYFTJDESA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
280.324 g/mol |
| Reported Formula |
C14H20N2O4 |
| SMILES |
N(\C(C(OC)=O)=C/N(C)C)c1cc(cc(c1)OC)OC |
| SPLASH |
splash10-0089-1490000000-d5ac3e09b98487a9aa90 |
| Source of Spectrum |
ARK-2014-35-3c |
| Thin-Layer Chromatography |
Rf = 0.73 (EtOAc) |
| Wiley ID |
1843250 |
![(Z)-Methyl 2-[(3,5-dimethoxyphenyl)amino]-3-(dimethylamino)acrylate](/api/spectrum/DV3XM4fovcR/structure.png?h=300&w=458 "(Z)-Methyl 2-[(3,5-dimethoxyphenyl)amino]-3-(dimethylamino)acrylate")
