| SpectraBase Spectrum ID |
DUoPc8U56Zw |
| Name |
Methotrimeprazine |
| CAS Registry Number |
60-99-1 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
328.160934574 u |
| Formula |
C19H24N2OS |
| InChI |
InChI=1S/C19H24N2OS/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21/h5-11,14H,12-13H2,1-4H3 |
| InChIKey |
VRQVVMDWGGWHTJ-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
328.474 g/mol |
| Nominal Mass |
328 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
329.168 |
| SMILES |
C1=2SC=3C(N(C2C=C(OC)C=C1)CC(CN(C)C)C)=CC=CC3 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-(2-methoxyphenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_479.5 |
