| SpectraBase Spectrum ID |
DPavLpiZIXf |
| Name |
Benztropine |
| CAS Registry Number |
86-13-5 |
| Collision Energy |
45 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
307.193614428 u |
| Formula |
C21H25NO |
| InChI |
InChI=1S/C21H25NO/c1-22-18-12-13-19(22)15-20(14-18)23-21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-21H,12-15H2,1H3 |
| InChIKey |
GIJXKZJWITVLHI-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
307.437 g/mol |
| Nominal Mass |
307 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
308.201 |
| SMILES |
C1(OC(C2=CC=CC=C2)C2=CC=CC=C2)C[C@@]2(N([C@@](CC2)(C1)[H])C)[H] |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
3-benzhydryloxy-8-methyl-8-azabicyclo[3.2.1]octane; methanesulfonic acid |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_96.8 |
