| SpectraBase Spectrum ID |
D1oSNS3w9qo |
| Name |
Butizide |
| CAS Registry Number |
2043-38-1 |
| Collision Energy |
50 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
353.027076051 u |
| Formula |
C11H16ClN3O4S2 |
| InChI |
InChI=1S/C11H16ClN3O4S2/c1-6(2)3-11-14-8-4-7(12)9(20(13,16)17)5-10(8)21(18,19)15-11/h4-6,11,14-15H,3H2,1-2H3,(H2,13,16,17) |
| InChIKey |
HGBFRHCDYZJRAO-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
353.839 g/mol |
| Nominal Mass |
353 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
354.034 |
| SMILES |
N1C=2C(=CC(S(=O)(=O)N)=C(C2)Cl)S(=O)(=O)NC1CC(C)C |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
6-chloro-3-(2-methylpropyl)-1,1-dioxo-3,4-dihydro-2H-1$l^{6},2,4-benzothiadiazine-7-sulfonamide |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_143.9 |
