| SpectraBase Spectrum ID |
CwjovPl9Zsc |
| Name |
Methyl 5-chloro-1H-indole-2-carboxylate |
| Appearance |
White solid |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C10H8ClNO2 |
| InChI |
InChI=1S/C10H8ClNO2/c1-14-10(13)9-5-6-4-7(11)2-3-8(6)12-9/h2-5,12H,1H3 |
| InChIKey |
WGAOEHZSJWVLBY-UHFFFAOYSA-N |
| Instrument Name |
Thermo-Finnigan Polaris Q and Jeol JSM-GCMateII |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.p008.138 |
| Molecular Weight |
209.632 g/mol |
| Reported Formula |
C10H8ClNO2 |
| SMILES |
[nH]1c2c(cc1C(OC)=O)cc(cc2)Cl |
| SPLASH |
splash10-05r0-6920000000-ac03a99ebe99d431f4f1 |
| Source of Spectrum |
ARK-2014-40-1e |
| Thin-Layer Chromatography |
Rf = 0.63 (hexane/EtOAc, 7:3) |
| Wiley ID |
1843224 |
