| SpectraBase Spectrum ID |
Cvl0UVFlDbW |
| Name |
Mebeverine |
| CAS Registry Number |
3625-06-7 |
| Collision Energy |
5 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
429.251523226 u |
| Formula |
C25H35NO5 |
| InChI |
InChI=1S/C25H35NO5/c1-6-26(19(2)17-20-9-12-22(28-3)13-10-20)15-7-8-16-31-25(27)21-11-14-23(29-4)24(18-21)30-5/h9-14,18-19H,6-8,15-17H2,1-5H3 |
| InChIKey |
VYVKHNNGDFVQGA-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
429.557 g/mol |
| Nominal Mass |
429 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
430.259 |
| SMILES |
C(OC(=O)C1=CC(OC)=C(OC)C=C1)CCCN(C(CC1=CC=C(OC)C=C1)C)CC |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
4-[ethyl-[1-(4-methoxyphenyl)propan-2-yl]amino]butyl 3,4-dimethoxybenzoate |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_511.9 |
