| SpectraBase Spectrum ID |
CiGyCxDIjA1 |
| Name |
Chloroxine |
| CAS Registry Number |
773-76-2 |
| Collision Energy |
40 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
212.974819184 u |
| Formula |
C9H5Cl2NO |
| InChI |
InChI=1S/C9H5Cl2NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8/h1-4,13H |
| InChIKey |
WDFKMLRRRCGAKS-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
N |
| Ionization Type |
ESI- |
| Molecular Weight |
214.051 g/mol |
| Nominal Mass |
213 u |
| Precursor Ion |
[M-H]- |
| Precursor m/z |
211.968 |
| SMILES |
OC=1C=2N=CC=CC2C(Cl)=CC1Cl |
| Selected Ion Charge |
-1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
5,7-dichloroquinolin-8-ol |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_-_8.7 |