| SpectraBase Spectrum ID |
CeISseMqNoD |
| Name |
Ethyl p-tolylacetate |
| Source of Sample |
TCI Chemicals India Pvt. Ltd. |
| Catalog Number |
T1227 |
| Lot Number |
GK01-IE0R |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
1 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
1 |
| Analog Signal 1 |
0.22257 |
| Analog Signal 2 |
0 |
| Aperture Setting |
2.5 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Backward Peak Amplitude |
2372 |
| Backward Peak Location |
28697 |
| Beam Splitter Setting |
Quartz |
| CAS Registry Number |
14062-19-2 |
| Calibration Lamp Spectrum |
Correction.0 |
| Color Properties |
Colorless |
| Container ID |
C-010258 |
| Copyright |
Copyright © 2017-2025 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
15 s |
| Detector Setting |
LN-Ge Diode [Internal Pos.2] |
| End Frequency Limit for File |
9394.3 |
| External Analog Signals |
Off |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C11H14O2 |
| Frequency of First Point |
3597.77 cm⁻¹ |
| Frequency of Last Point |
-0.855506 cm⁻¹ |
| High Folding Limit |
31596.9 |
| High Frequency Limit |
30000 cm⁻¹ |
| High Pass Filter |
1 |
| InChI |
InChI=1S/C11H14O2/c1-3-13-11(12)8-10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3 |
| InChIKey |
BTRGZBIXPLFVNK-UHFFFAOYSA-N |
| Instrument Name |
Bruker MultiRAM Stand Alone FT-Raman Spectrometer |
| Laser Wavenumber |
15798.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
5 |
| Measurement Channel |
Raman Compartment |
| Molecular Weight |
178.231 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
7465 |
| Number of Sample Scans |
242 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
2354 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
28687 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
power spectrum |
| Phase Resolution |
1 |
| Physical State |
Liquid |
| Preamplifier Gain |
0 |
| Purity |
>98.0% |
| Raman Background Corrected |
Yes |
| Raman Corrections |
Referenced to internal light source; Scattering corrected |
| Raman Laser Source |
Nd:YAG |
| Raman Scattering Corrected |
Yes |
| Relative Humidity Interferometer |
30 % |
| Resolution |
2 |
| SKU |
T1227-5G |
| SMILES |
c1cc(ccc1CC(=O)OCC)C |
| Sample Scans or Time |
Scans |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
2 |
| Scan Time |
794.665 s |
| Scanner Temperature |
25.8 °C |
| Scanner Velocity |
5 kHz |
| Signal Gain, Sample |
2 |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
5794.76 cm⁻¹ |
| Synonyms |
4-Methylphenylacetic acid ethyl ester; p-Tolylacetic acid ethyl ester |
| Technique |
FT-Raman |
| Temperature of Calibration Lamp |
2300 |
| Zero Filling Factor |
4 |
