| SpectraBase Spectrum ID |
CXEo4KfrXeE |
| Name |
8-Methoxyjulolidine |
| Source of Sample |
Alfa Aesar, Thermo Fisher Scientific |
| Catalog Number |
H34100 |
| Lot Number |
10165677 |
| Accessory |
TRANS *14560FA0 |
| Acquisition Mode |
double sided, forward-backward |
| Actual Signal Gain |
2 |
| Actual Signal Gain 2nd Channel |
1 |
| Additional Data Treatment |
0 |
| Analog Signal 1 |
0.270493 |
| Analog Signal 2 |
0 |
| Aperture Setting |
6 mm |
| Apodization Function |
Norton-Beer, medium |
| Background Measurement Channel |
Sample Compartment |
| Background Peak Amplitude 2nd Channel |
1 |
| Background Peak Location 2nd Channel |
1 |
| Background Scans |
16 |
| Background Scans or Time |
Scans |
| Backward Peak Amplitude |
-11191 |
| Backward Peak Location |
14479 |
| Beam Splitter Setting |
KBr |
| CAS Registry Number |
63468-83-7 |
| Color Properties |
Orange |
| Container ID |
C-010020 |
| Copyright |
Copyright © 2018-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Data Point Format |
1 |
| Delay Before Measurement |
0 s |
| Detector Setting |
RT-DLaTGS [Internal] |
| End Frequency Limit for File |
340 |
| External Synchronization |
Off |
| Focal Length |
100 |
| Formula |
C13H17NO |
| Frequency of First Point |
3999.54 cm⁻¹ |
| Frequency of Last Point |
339.945 cm⁻¹ |
| High Folding Limit |
15800.5 |
| High Frequency Limit |
8000 cm⁻¹ |
| High Pass Filter |
0 |
| InChI |
InChI=1S/C13H17NO/c1-15-12-7-6-10-4-2-8-14-9-3-5-11(12)13(10)14/h6-7H,2-5,8-9H2,1H3 |
| InChIKey |
ZSKPEBROOQBZNW-UHFFFAOYSA-N |
| Instrument Name |
Bruker Tensor 27 FT-IR |
| Laser Wavenumber |
15800.5 cm⁻¹ |
| Low Folding Limit |
0 |
| Low Frequency Limit |
0 |
| Low Pass Filter |
10 |
| Molecular Weight |
203.285 g/mol |
| Non Linearity Correction |
0 |
| Number of Points |
15180 |
| Number of Sample Scans |
16 |
| Optical Filter Setting |
Open |
| Peak Amplitude |
-11167 |
| Peak Amplitude 2nd Channel |
1 |
| Peak Location |
14476 |
| Peak Location 2nd Channel |
1 |
| Phase Correction Mode |
Mertz |
| Phase Resolution |
4 |
| Preamplifier Gain Background |
0 |
| Purity |
95% |
| Relative Humidity Interferometer |
20 % |
| Resolution |
2 |
| SKU |
H34100-1G |
| SMILES |
c12N3CCCc2ccc(c1CCC3)OC |
| Sample Spacing Divisor |
1 |
| Sample Spacing Multiplicator |
1 |
| Scan Time |
24.99 s |
| Scanner Temperature |
29.4 °C |
| Scanner Velocity |
10 kHz |
| Signal Gain, Background |
automatic |
| Source of Spectrum |
Bio-Rad Laboratories, Inc. |
| Start Frequency Limit for File |
4000 cm⁻¹ |
| Synonyms |
8-Methoxy-1,2,3,5,6,7-hexahydropyrido[3,2,1-ij]quinoline |
| Technique |
Neat |
| Window |
KBr Window - 1 Side |
| Zero Filling Factor |
8 |
