| SpectraBase Spectrum ID |
C0wixGwGZsE |
| Name |
7-Aminoflunitrazepam |
| CAS Registry Number |
34084-50-9 |
| Collision Energy |
25 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
283.112090245 u |
| Formula |
C16H14FN3O |
| InChI |
InChI=1S/C16H14FN3O/c1-20-14-7-6-10(18)8-12(14)16(19-9-15(20)21)11-4-2-3-5-13(11)17/h2-8H,9,18H2,1H3 |
| InChIKey |
LTCDLGUFORGHGY-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
283.306 g/mol |
| Nominal Mass |
283 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
284.119 |
| SMILES |
NC1=CC2=C(N(C(=O)CN=C2C=2C(F)=CC=CC2)C)C=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
7-amino-5-(2-fluorophenyl)-1-methyl-3H-1,4-benzodiazepin-2-one |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_18.4 |
