| SpectraBase Spectrum ID |
Butd58LDi5f |
| Name |
N-Phenylphthalimide |
| CAS Registry Number |
520-03-6 |
| Collision Energy |
30 eV |
| Copyright |
Copyright © 2012-2025 Herbert Oberacher. All Rights Reserved. |
| Exact Mass |
223.063328532 u |
| Formula |
C14H9NO2 |
| InChI |
InChI=1S/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H |
| InChIKey |
MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| Instrument Name |
QStar XL, AB Sciex |
| Ion Polarity |
P |
| Ionization Type |
ESI+ |
| Molecular Weight |
223.231 g/mol |
| Nominal Mass |
223 u |
| Precursor Ion |
[M+H]+ |
| Precursor m/z |
224.071 |
| SMILES |
C1(=O)N(C(=O)C=2C1=CC=CC2)C1=CC=CC=C1 |
| Selected Ion Charge |
1 |
| Source of Spectrum |
Herbert Oberacher, Institute of Legal Medicine, Innsbruck/Austria |
| Spectrum Type |
ms2 |
| Synonyms |
2-phenylisoindole-1,3-dione |
| Technique |
Q-TOF |
| Wiley ID |
MSforID_+_754.5 |