| SpectraBase Spectrum ID |
Bsd9dBNdWP1 |
| Name |
(4SR)-(??)-1,4-Dimethyl-4-phenylsulfanyl-1,2,3,4-tetrahydrochinoline |
| Appearance |
Yellow oil |
| Copyright |
Copyright © 2020-2024 John Wiley & Sons, Inc. All Rights Reserved. |
| Formula |
C17H19NS |
| InChI |
InChI=1S/C17H19NS/c1-17(19-14-8-4-3-5-9-14)12-13-18(2)16-11-7-6-10-15(16)17/h3-11H,12-13H2,1-2H3 |
| InChIKey |
JNKXMIAIWMLAPZ-UHFFFAOYSA-N |
| Instrument Name |
Varian MAT 311A and Varian MAT 731 |
| Ionization Type |
EI |
| Literature Reference DOI |
10.3998/ark.5550190.0006.514 |
| Molecular Weight |
269.406 g/mol |
| SMILES |
c1cc2c(cc1)N(CCC2(Sc1ccccc1)C)C |
| SPLASH |
splash10-03di-1910000000-ac31cbcad894cf6b905c |
| Source of Spectrum |
ARK-2005-169-55 |
| Thin-Layer Chromatography |
Rf = 0.26 (diethyl ether/petroleum ether, 1:30) |
| Wiley ID |
1871038 |
